![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/compressed.gif) | 711-01873 Cover Plate, Large Aperture, QuadSwitch.zip | 2024-06-24 23:42 | 741K | |
![[ ]](/icons/compressed.gif) | 711-01874 Cover Plate, Solid, QuadSwitch.zip | 2024-06-24 23:42 | 724K | |
![[ ]](/icons/compressed.gif) | 710-00771-C CSK 3U Fixed Front Solar Panel 031.zip | 2024-06-11 17:34 | 377K | |
![[ ]](/icons/compressed.gif) | 710-00772-C CSK 3U Fixed Side Solar Panel 031.zip | 2024-06-11 17:34 | 378K | |
![[ ]](/icons/compressed.gif) | 710-02092 220W DCSA - Deployed.zip | 2023-07-05 12:50 | 19M | |
![[ ]](/icons/compressed.gif) | 710-02092 220W DCSA - Stowed.zip | 2023-07-05 12:50 | 16M | |
![[ ]](/icons/compressed.gif) | 710-01552-F Battery Module 2 (BM2) with BSM - without brackets.zip | 2023-05-04 13:07 | 6.2M | |
![[ ]](/icons/compressed.gif) | 710-01552-F Battery Module 2 (BM2) with BSM.zip | 2023-05-04 13:07 | 6.7M | |
![[ ]](/icons/compressed.gif) | 710-01552-F Battery Module 2 (BM2) - without brackets.zip | 2023-05-04 13:07 | 2.9M | |
![[ ]](/icons/compressed.gif) | 710-01552-F Battery Module 2 (BM2).zip | 2023-05-04 13:07 | 3.4M | |
![[DIR]](/icons/folder.gif) | BM2 Archive/ | 2023-05-04 13:03 | - | |
![[ ]](/icons/compressed.gif) | 710-01952-C EPSM 1.zip | 2023-02-23 12:45 | 20M | |
![[ ]](/icons/compressed.gif) | 710-02124-B CSK 2U Fixed Front Solar Panel 031.zip | 2020-02-05 11:21 | 403K | |
![[ ]](/icons/compressed.gif) | 710-02203-A0 Base Plate, Large Aperture, Dual Switch.zip | 2019-12-23 13:53 | 644K | |
![[ ]](/icons/compressed.gif) | 710-00960-A0 Base Plate, ANTS, Dual Switch.zip | 2019-12-23 11:58 | 728K | |
![[ ]](/icons/compressed.gif) | 710-02172-A0 Cover Plate, ANTS, Dual Switch.zip | 2019-12-23 11:29 | 579K | |
![[ ]](/icons/compressed.gif) | 715-01367 SUPERNOVA 6U.zip | 2019-10-02 14:13 | 30M | |
![[ ]](/icons/compressed.gif) | 710-02092-A DCSA 12 Panel.zip | 2019-09-03 13:31 | 25M | |
![[ ]](/icons/compressed.gif) | 710-00521-B IO LED Module.zip | 2019-08-26 09:54 | 1.0M | |
![[ ]](/icons/compressed.gif) | 710-02111 SUPERNOVA 12U Structure Kit.zip | 2019-07-18 12:20 | 3.5M | |
![[ ]](/icons/compressed.gif) | NSL EyeStar-S3 Simplex v6.zip | 2019-06-18 13:23 | 538K | |
![[ ]](/icons/compressed.gif) | NSL Simplex Antenna with EHS v4.2.zip | 2019-06-18 13:13 | 358K | |
![[ ]](/icons/compressed.gif) | 710-00771-B CSK 3U Fixed Front Solar Panel 031.zip | 2019-06-03 09:44 | 342K | |
![[ ]](/icons/compressed.gif) | 710-00772-B CSK 3U Fixed Side Solar Panel 031.zip | 2019-05-30 17:20 | 346K | |
![[ ]](/icons/compressed.gif) | 710-00770-B CSK 2U Fixed Side Solar Panel 031.zip | 2019-05-30 17:19 | 395K | |
![[ ]](/icons/compressed.gif) | 710-00768-A CSK 1.5U Fixed Side Solar Panel 031.zip | 2019-05-30 16:23 | 312K | |
![[ ]](/icons/compressed.gif) | 710-00766-A CSK 1U Fixed Side Solar Panel 031.zip | 2019-05-30 15:58 | 337K | |
![[ ]](/icons/compressed.gif) | 710-00764-G CSK Fixed End Solar Panel.zip | 2019-05-30 15:32 | 282K | |
![[ ]](/icons/compressed.gif) | 710-00837-B ANTS End Solar Panel.zip | 2019-04-03 10:47 | 304K | |
![[ ]](/icons/compressed.gif) | 710-02070-A0 Payload Cover Plate.zip | 2019-02-07 12:11 | 218K | |
![[ ]](/icons/compressed.gif) | 710-02069-A DCSA 11 Panel.zip | 2019-02-05 15:58 | 13M | |
![[ ]](/icons/compressed.gif) | 710-02068-A DCSA 9 Panel.zip | 2019-02-05 15:31 | 12M | |
![[ ]](/icons/compressed.gif) | 710-01764-A Battery Switch Module.zip | 2019-02-05 11:38 | 6.9M | |
![[ ]](/icons/compressed.gif) | 710-00484-E Motherboard Module Non-Stackthrough.zip | 2018-09-24 13:01 | 5.7M | |
![[ ]](/icons/compressed.gif) | 710-00484-E Motherboard Module.zip | 2018-09-20 17:37 | 5.4M | |
![[ ]](/icons/compressed.gif) | 710-00748-A Pluggable Processor Module E1.zip | 2018-09-11 17:22 | 3.7M | |
![[ ]](/icons/compressed.gif) | 710-00487-A Pluggable Process Module B1.zip | 2018-09-11 16:11 | 242K | |
![[ ]](/icons/compressed.gif) | 710-00528-A Pluggable Processor Module D2.zip | 2018-09-11 16:06 | 243K | |
![[ ]](/icons/compressed.gif) | 710-00527-A Pluggable Processor Module D1.zip | 2018-09-11 16:02 | 251K | |
![[ ]](/icons/compressed.gif) | 710-01362-E Motherboard Module 2.zip | 2018-06-19 17:14 | 9.6M | |
![[ ]](/icons/compressed.gif) | NSL EyeStar-D2 Duplex EM.zip | 2018-05-23 14:32 | 2.3M | |
![[ ]](/icons/compressed.gif) | NSL EyeStar-D2 Duplex FM.zip | 2018-05-23 11:22 | 2.1M | |
![[ ]](/icons/compressed.gif) | NSL Duplex Antenna.zip | 2018-04-27 12:03 | 33K | |
![[ ]](/icons/compressed.gif) | 634-01101 CubeSat Kit Remove-Before-Flight (RBF) Switch.zip | 2017-12-12 16:01 | 49K | |
![[ ]](/icons/compressed.gif) | 634-01100 CubeSat Kit Separation Switch.zip | 2017-12-12 16:01 | 35K | |
![[ ]](/icons/compressed.gif) | 710-00713-A0 Cover Plate, Large Aperture, Dual Switch.zip | 2017-11-14 09:15 | 306K | |
![[ ]](/icons/compressed.gif) | 710-00683-A0 Cover Plate, Large Aperture.zip | 2017-11-14 09:09 | 266K | |
![[ ]](/icons/compressed.gif) | 711-00841 2U Rod & Spacer Kit.zip | 2017-11-13 18:43 | 410K | |
![[ ]](/icons/compressed.gif) | 711-00842 3U Rod & Spacer Kit.zip | 2017-11-13 18:41 | 627K | |
![[ ]](/icons/compressed.gif) | 711-00840 1.5U Rod & Spacer Kit.zip | 2017-11-13 18:38 | 303K | |
![[ ]](/icons/compressed.gif) | 711-00839 1U Rod & Spacer Kit.zip | 2017-11-13 18:34 | 196K | |
![[ ]](/icons/compressed.gif) | 711-00320-A Motherboard Mockup (With Switch).zip | 2017-11-13 18:21 | 1.3M | |
![[ ]](/icons/compressed.gif) | 711-00320-A Motherboard Mockup Module.zip | 2017-11-13 18:18 | 1.1M | |
![[ ]](/icons/compressed.gif) | 710-00784-A0 Cover Plate, ANTS.zip | 2017-11-13 18:13 | 325K | |
![[ ]](/icons/compressed.gif) | 711-00782-A Solar Clip Set, ANTS .062.zip | 2017-11-13 17:57 | 45K | |
![[ ]](/icons/compressed.gif) | 711-01002-A Solar Clip Set, ANTS .031.zip | 2017-11-13 17:53 | 45K | |
![[ ]](/icons/compressed.gif) | 710-00783-A0 Base Plate, ANTS, Single Switch.zip | 2017-11-13 17:50 | 549K | |
![[ ]](/icons/compressed.gif) | 710-00837-A ANTS End Solar Panel.zip | 2017-11-13 17:40 | 290K | |
![[ ]](/icons/compressed.gif) | 711-00416 MAI-100 ADACS Kit.zip | 2017-11-13 17:36 | 2.3M | |
![[ ]](/icons/compressed.gif) | 711-00700 MAI-200 ADACS Kit.zip | 2017-11-13 17:33 | 2.3M | |
![[ ]](/icons/compressed.gif) | 711-00803 MAI-400 ADACS Kit.zip | 2017-11-13 17:32 | 3.0M | |
![[ ]](/icons/compressed.gif) | 711-01009 BCT XACT (3DRW0198) ADACS Kit.zip | 2017-11-13 17:29 | 1.1M | |
![[ ]](/icons/compressed.gif) | 717-01105 ISARA Solar Reflector Array.zip | 2017-11-13 17:27 | 10M | |
![[ ]](/icons/compressed.gif) | 710-00509-A MSP-TS430PM64 Adapter.zip | 2017-11-13 17:23 | 3.6M | |
![[ ]](/icons/compressed.gif) | 710-01270-B SUPERNOVA 8 Cell Side Panel.zip | 2017-11-13 17:08 | 367K | |
![[ ]](/icons/compressed.gif) | 710-01269-B SUPERNOVA 24 Cell Panel.zip | 2017-11-13 17:03 | 1.0M | |
![[ ]](/icons/compressed.gif) | 710-00790 Turkey Tail Array 11-Panel EVM.zip | 2017-11-13 16:57 | 16M | |
![[ ]](/icons/compressed.gif) | 710-00788 Turkey Tail Array 9-Panel EVM.zip | 2017-11-13 16:55 | 13M | |
![[ ]](/icons/compressed.gif) | 710-00786 Turkey Tail 7-Panel Array EVM.zip | 2017-11-13 16:53 | 11M | |
![[ ]](/icons/compressed.gif) | 711-00792-B Solar Clip Set, .031.zip | 2017-11-13 16:12 | 71K | |
![[ ]](/icons/compressed.gif) | 711-00346-C Solar Clip Set, .062.zip | 2017-11-13 16:10 | 73K | |
![[ ]](/icons/compressed.gif) | 710-00789 Turkey Tail Array 11-Panel.zip | 2017-11-13 15:57 | 16M | |
![[ ]](/icons/compressed.gif) | 710-00787 Turkey Tail Array 9-Panel.zip | 2017-11-13 15:53 | 13M | |
![[ ]](/icons/compressed.gif) | 710-00785 Turkey Tail 7-Panel Array.zip | 2017-11-13 15:50 | 11M | |
![[ ]](/icons/compressed.gif) | 710-01390-B Bus Interface Module 1.zip | 2017-11-13 15:45 | 4.4M | |
![[ ]](/icons/compressed.gif) | 710-00908-D GPS Receiver Module 1 Non-Stackthrough.zip | 2017-11-13 15:39 | 3.7M | |
![[ ]](/icons/compressed.gif) | 710-00608-A Pluggable Socketed Processor Module D.zip | 2017-11-13 15:28 | 3.4M | |
![[ ]](/icons/compressed.gif) | 710-00607-B Pluggable Socketed Processor Module B.zip | 2017-11-13 15:25 | 3.4M | |
![[ ]](/icons/compressed.gif) | 703-00292-E0 3U Chassis Skeleton.zip | 2017-11-13 15:18 | 1.3M | |
![[ ]](/icons/compressed.gif) | 703-00245-E0 3U Chassis Solid.zip | 2017-11-13 14:58 | 967K | |
![[ ]](/icons/compressed.gif) | 703-00291-E0 2U Chassis Skeleton.zip | 2017-11-13 14:32 | 1.1M | |
![[ ]](/icons/compressed.gif) | 703-00244-E0 2U Chassis Solid.zip | 2017-11-13 14:17 | 919K | |
![[ ]](/icons/compressed.gif) | 703-00290-E0 1.5U Chassis Skeleton.zip | 2017-11-13 13:52 | 1.1M | |
![[ ]](/icons/compressed.gif) | 703-00287-E0 1.5U Chassis Solid.zip | 2017-11-13 13:24 | 872K | |
![[ ]](/icons/compressed.gif) | 710-00794-E0 Base Plate, Skeleton, Dual Switch.zip | 2017-11-13 12:54 | 720K | |
![[ ]](/icons/compressed.gif) | 710-00793-E0 Base Plate, Solid, Dual Switch.zip | 2017-11-13 12:49 | 701K | |
![[ ]](/icons/compressed.gif) | 710-00294-D1 Base Plate, Skeleton, Single Switch.zip | 2017-11-13 12:44 | 519K | |
![[ ]](/icons/compressed.gif) | 710-00293-D2 Base Plate, Solid, Single Switch.zip | 2017-11-13 12:37 | 506K | |
![[ ]](/icons/compressed.gif) | 710-00296-D0 Cover Plate, Skeleton.zip | 2017-11-13 12:25 | 243K | |
![[ ]](/icons/compressed.gif) | 710-00295-D0 Cover Plate, Solid.zip | 2017-11-13 12:18 | 231K | |
![[ ]](/icons/compressed.gif) | 703-00289-E0 1U Chassis Skeleton.zip | 2017-11-13 11:58 | 1.0M | |
![[ ]](/icons/compressed.gif) | 703-00243-E0 1U Chassis Solid.zip | 2017-11-13 11:21 | 882K | |
![[ ]](/icons/compressed.gif) | 710-01766-D Payload Interface Module.zip | 2017-11-13 10:40 | 6.8M | |
![[ ]](/icons/compressed.gif) | 710-00651-A Load Module.zip | 2017-11-13 09:45 | 1.0M | |
![[ ]](/icons/compressed.gif) | 710-01362-D Motherboard Module 2.zip | 2017-11-13 09:32 | 8.8M | |
![[ ]](/icons/compressed.gif) | 703-00398-B0 Payload Adapter Plate.zip | 2017-11-10 16:33 | 150K | |
![[ ]](/icons/compressed.gif) | 703-00397-B0 ADACS Payload Walls.zip | 2017-11-10 16:25 | 81K | |
![[ ]](/icons/compressed.gif) | 711-00331-A Midplane Standoffs.zip | 2017-11-10 16:14 | 113K | |
![[ ]](/icons/compressed.gif) | 711-00330-E RBF Bracket.zip | 2017-11-10 16:11 | 70K | |
![[ ]](/icons/compressed.gif) | 711-00380-A Breakout Board Module.zip | 2017-11-10 11:55 | 1.0M | |
![[ ]](/icons/compressed.gif) | 710-00516-B Pluggable Processor Module A3.zip | 2017-11-10 09:57 | 182K | |
![[ ]](/icons/compressed.gif) | 710-00486-B Pluggable Processor Module A2.zip | 2017-11-10 09:46 | 182K | |
![[ ]](/icons/compressed.gif) | 710-00485-B Pluggable Processor Module A1.zip | 2017-11-10 09:40 | 182K | |
![[ ]](/icons/compressed.gif) | 710-00484-D Motherboard Module.zip | 2017-11-10 09:27 | 2.2M | |
![[ ]](/icons/compressed.gif) | 710-00484-D Motherboard Module Non-Stackthrough.zip | 2017-11-10 09:23 | 2.2M | |
![[ ]](/icons/compressed.gif) | 711-00303-B Protoboard Module Kit.zip | 2017-11-09 17:48 | 1.0M | |
![[ ]](/icons/compressed.gif) | 710-00908-D GPS Receiver Module 1.zip | 2017-11-09 17:40 | 4.1M | |
![[ ]](/icons/compressed.gif) | 711-00338-D Linear EPS Module.zip | 2017-11-09 17:12 | 1.0M | |
|